Sitagliptin phosphate 10mM * 1mL in DMSO
Sitagliptin phosphate is an anti-diabetic (antihyperglycemic) drug of the dipeptidyl peptidase-4 (DPP-4) class. Inhibition of the enzyme DPP-4 is thought to increase Glucagon-like peptide-1 (GLP-1) which inhibits glucagon release , stimulates the insulin release and lowers blood glucose.
| Trivial name | Sitagliptin phosphate 10mM * 1mL in DMSO |
| Catalog Number | A10848-10mM-D |
| Alternative Name(s) | (R)-3-amino-1-(3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)-4-(2,4,5-trifluorophenyl)butan-1-one phosphate monohydrate |
| Molecular Formula | C16H15F6N5O.H3PO4.H2O |
| CAS# | 654671-77-9 |
| SMILES | C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)C[C@@H](CC3=CC(=C(C=C3F)F)F)N.O.OP(=O)(O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/sitagliptin-phosphate-monohydrate.html |
