6′-Methyl paeonol | MedChemExpress (MCE)
6’-Methyl paeonol is a paeonol derivative, which inihibits abnormal depolarizations and reduces the Amyloid β-induced ERK phosphorylation. 6’-Methyl paeonol exhibits alleviating activity against Alzheimer’s Disease[1].
| Trivial name | 6′-Methyl paeonol |
| Catalog Number | HY-163283 |
| Research Area | Neurological Disease |
| CAS# | 6540-66-5 |
| Purity | ≥98.0% |
| SMILES | O=C(C)C1=C(C)C=C(OC)C=C1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/6-methyl-paeonol.html |