Bestatin hydrochloride
Bestatin hydrochloride is a reversible inhibitor of aminopeptidase enzymes, namely Aminopeptidase B, Aminopeptidase M (CD13), and leucine aminopeptidase (LAP3). Inhibition of these proteins by bestatin correlates to apoptosis induction in oncogenic cells. Bestatin is also a potent inhibitor of leukotriene A4 hydrolase (LTA4). It is potentially used for cancer treatment.
| Catalog Number | R1028 |
| Alternative Name(s) | Aminopeptidase inhibitor, leucine aminopeptidase, aminopeptidase B, NK-421 |
| Molecular Formula | C16H24N2O4 · HCl |
| CAS# | 65391-42-6 |
| Purity | >98% |
| Inchi | InChI=1S/C16H24N2O4.ClH/c1-10(2)8-13(16(21)22)18-15(20)14(19)12(17)9-11-6-4-3-5-7-11;/h3-7,10,12-14,19H,8-9,17H2,1-2H3,(H,18,20)(H,21,22);1H/t12-,13+,14+;/m1./s1 |
| Inchi Key | XGDFITZJGKUSDK-UDYGKFQRSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H]([C@@H](CC1=CC=CC=C1)N)O.Cl |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/bestatin-hydrochloride-item-r1028-34830.html |