Bestatin Methyl Ester 10mg
Bestatin methyl ester is a cell-permeable derivative of Bestatin which displays slightly stronger inhibition of neutral aminopeptidase than Bestatin, but has much weaker activity against basic aminopeptidase.
| Trivial name | Bestatin Methyl Ester 10mg |
| Catalog Number | A13592-10 |
| Alternative Name(s) | methyl (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoate |
| Molecular Formula | C17H26N2O4 |
| CAS# | 65322-89-6 |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC(=O)[C@H]([C@@H](CC1=CC=CC=C1)N)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/bestatin-methyl-ester.html |
