Ketoconazole 100mg
As an antifungal, ketoconazole is structurally similar to imidazole, and interferes with the fungal synthesis of ergosterol, a constituent of fungal cell membranes, as well as certain enzymes.
Trivial name | Ketoconazole 100mg |
Catalog Number | A10498-100 |
Alternative Name(s) | 1-[4-(4-{[(2R,4S)-2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]ethan-1-one |
Molecular Formula | C26H28Cl2N4O4 |
CAS# | 65277-42-1 |
SMILES | CC(=O)N1CCN(CC1)C2=CC=C(C=C2)OC[C@H]3CO[C@](O3)(CN4C=CN=C4)C5=C(C=C(C=C5)Cl)Cl |
Size | 100mg |
Supplier Page | http://www.adooq.com/ketoconazole.html |