Isosorbide
API Standard
| Catalog Number | CS-O-30603 |
| Alternative Name(s) | (3R,3aR,6S,6aR)-hexahydrofuro[3,2-b]furan-3,6-diol |
| Research Area | Isosorbide is an organic nitrate with vasodilator activity. Isosorbide relaxes vascular smooth muscle by formation of the free radical nitric oxide (NO), which is identical to the endothelium-derived relaxing factor (EDRF). NO activates guanylyl cyclase, |
| Molecular Formula | C6H10O4 |
| CAS# | 652-67-5 |
| Purity | >98% |
| SMILES | O[C@@H]1[C@](OC[C@H]2O)([H])[C@]2([H])OC1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30603.html |