Nanchangmycin
Nanchangmycin is a polyether antibiotic with similar structure to dianemycin and is very active against a broad spectrum of harmful nematodes and insects but not for mammals and plants.
| Trivial name | / |
| Catalog Number | CSN19070 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C47H77NaO14 |
| CAS# | 65101-87-3 |
| Purity | ≥98% |
| SMILES | C[C@H]1[C@@]2(O[C@](C[C@@H]2C)([C@@]3([H])O[C@](CO)(O)[C@H](C)C[C@@H]3C)[H])O[C@](C[C@@H]1O[C@@]4([H])O[C@@H]([C@@H](OC)CC4)C)([C@]5(O[C@]6(O[C@]([C@@H](C)/C=C(C)/C([C@H](C)C[C@H](C)C([O-])=O)=O)([C@H](C)[C@@H](O)C6)[H])CC5)C)[H].[Na+] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/nanchangmycin.html |