Nanchangmycin 10mM * 1mL in DMSO
Nanchangmycin (dianemycin) is a polyether antibiotic with similar structure to dianemycin and is very active against a broad spectrum of harmful nematodes and insects but not for for mammals and plants.
| Trivial name | Nanchangmycin 10mM * 1mL in DMSO |
| Catalog Number | A10621-10mM-D |
| Alternative Name(s) | Dianemycin 1-sodium salt |
| Molecular Formula | C48H80O13 |
| CAS# | 65101-87-3 |
| SMILES | C[C@H]1C[C@H]([C@@](O[C@@H]1[C@H]2C[C@@H]([C@@]3(O2)[C@@H]([C@H](C[C@@H](O3)[C@@]4(CC[C@@]5(O4)C[C@@H]([C@H]([C@H](O5)[C@@H](C)/C=C(C)/C(=O)[C@H](C)C[C@H](C)C(=O)[O-])C)O)C)OC6CC[C@@H]([C@H](O6)C)OC)C)C)(CO)O)C.[Na+] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/nanchangmycin.html |