Sulfameter
Sulfameter a long-acting sulfonamide antibiotic used as a leprostatic agent and to treat urinary tract infections, which blocks the synthesis of dihydrofolic acid by inhibiting the enzyme dihydropteroate synthase as a competitive inhibitors of bacterial para-aminobenzoic acid.
| Trivial name | Sulfametoxydiazine |
| Catalog Number | CSN11047 |
| Alternative Name(s) | Sulfametoxydiazine |
| Research Area | Infection |
| Molecular Formula | C11H12N4O3S |
| CAS# | 651-06-9 |
| Purity | ≥99% |
| SMILES | O=S(C1=CC=C(N)C=C1)(NC2=NC=C(OC)C=N2)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/sulfameter.html |
