Ethacrynate Sodium
Ethacrynate Sodium (ethacrynic acid sodium) is the sodium salt form of ethacrynic acid, which inhibits symport of sodium, potassium, and chloride primarily in the ascending limb of Henle, but also in the proximal and distal tubules.
| Trivial name | ethacrynic acid sodium |
| Catalog Number | S5847 |
| Molecular Formula | C11H18ClN7O |
| CAS# | 6500-81-8 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCN(C(C)C)C1=C(Cl)N=C(C(=N1)N)C(=O)NC(N)=N |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/ethacrynate-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/ethacrynate-sodium-chemical-structure-s5847.gif |
