H-Leu-Leu-OMe Hydrochloride
H-Leu-Leu-OMe Hydrochloride (H-LEU-LEU-OME HCL, L-Leucyl-L-Leucine methyl ester), a dipeptide condensation product of L-leucine methyl ester generated by human monocytes or polymorphonuclear leukocytes, selectively eliminates lymphocytes with cytotoxic potential, also can induce endolysosomal pathway stress.
| Trivial name | H-LEU-LEU-OME HCL, L-Leucyl-L-Leucine methyl ester |
| Catalog Number | E2634 |
| Molecular Formula | C13H26N2O3.ClH |
| CAS# | 6491-83-4 |
| SMILES | Cl.COC(=O)C(CC(C)C)NC(=O)C(N)CC(C)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/h-leu-leu-ome-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e2634-H-Leu-Leu-OMe-Hydrochloride-chemical-structure.png |