Butoconazole nitrate
Butoconazole nitrate (RS-35887) is an anti-fungal agent that inhibits PHA-stimulated release of cytokines– IL-2, TNFα, IFN and GM-CSF from human peripheral blood lymphocytes (IC50 of 7.2 μg/mL, 14.4 μg/mL, 7.36 μg/mL and 7.6 μg/mL, respectively).
| Trivial name | RS-35887 |
| Catalog Number | S1833 |
| Molecular Formula | C19H17Cl3N2S.HNO3 |
| CAS# | 64872-77-1 |
| Inchi | InChI=1S/C19H17Cl3N2S.HNO3/c20-15-7-4-14(5-8-15)6-9-16(12-24-11-10-23-13-24)25-19-17(21)2-1-3-18(19)22;2-1(3)4/h1-5,7-8,10-11,13,16H,6,9,12H2;(H,2,3,4) |
| Inchi Key | ZHPWRQIPPNZNML-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)SC(CCC2=CC=C(C=C2)Cl)CN3C=CN=C3)Cl.[N+](=O)(O)[O-] |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/butoconazole-nitrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Butoconazole-nitrate-chemical-structure-s1833.gif |