Iodoethane D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-56727 |
| Alternative Name(s) | 1-iodo(D5)ethane |
| Research Area | Labeled 1-Iodoethane, which is used in a variety of organic chemical reactions including the synthesis if disubstituted a-amino acids through alkylation reaction. Also used in electrochemical reduction reactions in the preparation of carbamates. |
| Molecular Formula | C2D5I |
| CAS# | 6485-58-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | IC([2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST56727.html |
| Additional Information | NULL |