(R)-(-)-Carvone
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-68907 |
| Alternative Name(s) | (5R)-2-Methyl-5-(1-methylethenyl)-2-cyclohexen-1-one; (R)-(-)-p-Mentha-6,8-dien-2-one; (-)-(5R)-Carvone; (-)-(R)-Carvone; (-)-p-Mentha-6,8-dien-2-one; (4R)-(-)-Carvone; (R)-Carvone; (R)-Carvone; L-(-)-Carvone; L-Carvone; R-(-)-Carvone; l-1-Methyl-4-isopropenyl-6-cyclohexen-2-one; l-Carvone; |
| Research Area | (R)-(-)-Carvone, is an antinociceptive monoterpene found as the main active constituent of essential oils obtained from plants of the genus Mentha. It is a novel agonist of TRPV1 channels. It can also be used as a chiral starting material. |
| Molecular Formula | C₁₀H₁₄O |
| CAS# | 6485-40-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C(C)=CC[C@@H](C(C)=C)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST68907.html |
| Additional Information | NULL |
