AS-605240 50mg
AS-605240 is an orally active inhibitor of PI3-kinase ?? that inhibits human recombinant PI3K??, ??, ??, and ?? in an ATP-competitive manner with IC50 values of 8, 60, 270, and 300 nM, respectively.
| Trivial name | AS-605240 50mg |
| Catalog Number | A10088-50 |
| Alternative Name(s) | 5-(6-Quinoxalinylmethylene)-2,4-thiazolidine-2,4-dione |
| Molecular Formula | C12H7N3O2S |
| CAS# | 648450-29-7 |
| SMILES | C1=CC2=NC=CN=C2C=C1/C=C3/C(=O)NC(=O)S3 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/as-605240.html |
