Sophocarpine 10mM * 1mL in DMSO
Sophocarpine could reverse isoprenaline-induced arrhythmia and inhibit I(Na), I(CaL), and I(Kr) currents. The electrophysiological effects of sophocarpine are similar to those of amiodarone, which might be regarded as a prospective antiarrhythmic agent.
| Trivial name | Sophocarpine 10mM * 1mL in DMSO |
| Catalog Number | A10857-10mM-D |
| Alternative Name(s) | (7aS,13aR,13bR,13cS)-2,3,6,7,7a,8,13,13a,13b,13c-Decahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one |
| Molecular Formula | C15H22N2O |
| CAS# | 6483-15-4 |
| SMILES | C1C[C@H]2CN3[C@H](CC=CC3=O)[C@@H]4[C@H]2N(C1)CCC4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/sophocarpine.html |