Azumolene
Azumolene, an analog of dantrolene, is a muscle relaxant that inhibits the release of calcium from skeletal muscle sarcoplasmic reticulum by modulating the activity of the SR ryanodine receptor (RyR) Ca2+ release channel.
| Trivial name | EU4093; 1-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]methylideneamino]imidazolidine-2,4-dione |
| Catalog Number | CSN27668 |
| Alternative Name(s) | EU4093; 1-[[5-(4-bromophenyl)-1,3-oxazol-2-yl]methylideneamino]imidazolidine-2,4-dione |
| Research Area | Membrane Transporter/Ion Channel |
| Molecular Formula | C13H9BrN4O3 |
| CAS# | 64748-79-4 |
| Purity | ≥98% |
| SMILES | O=C1NC(CN1/N=C/C2=NC=C(C3=CC=C(Br)C=C3)O2)=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/1-(((5-(4-bromophenyl)oxazol-2-yl)methylene)amino)imidazolidine-2,4-dione.html |