2C-I HCl 50mg
Like other 2Cs, 2C-I (hydrochloride) is a monoamine oxidase inhibitor, blocking the breakdown of serotonin and norepinephrine (IC50 values of 79 and 37 ??M, respectively), but not dopamine.
| Trivial name | 2C-I HCl 50mg |
| Catalog Number | A14176-50 |
| Alternative Name(s) | 4-iodo-2,5-dimethoxy-benzeneethanamine,? monohydrochloride |
| Molecular Formula | C10H14INO2.HCl |
| CAS# | 64584-32-3 |
| SMILES | COC1=CC(=C(C=C1CCN)OC)I.Cl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/2c-i-hcl.html |