Cefotaxime Sodium
Cefotaxime Sodium is a semisynthetic third-generation cephalosporin antibiotic used to treat joint infections, pelvic inflammatory disease, meningitis, pneumonia, urinary tract infections, sepsis, gonorrhea, and cellulitis.
| Trivial name | Cefotaxime Sodium Salt |
| Catalog Number | CSN12861 |
| Alternative Name(s) | Cefotaxime Sodium Salt |
| Research Area | Infection |
| Molecular Formula | C16H16N5NaO7S2 |
| CAS# | 64485-93-4 |
| Purity | ≥98% |
| SMILES | O=C([O-])C(N1[C@@]([H])([C@@H](C1=O)NC(/C(C2=CSC(N)=N2)=N/OC)=O)SC3)=C3COC(C)=O.[Na+] |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/cefotaxime-sodium.html |