Cefotaxime Sodium
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01071 |
| Alternative Name(s) | NULL |
| Research Area | Broad spectrum third generation cephalosporin antibiotic. The name Cefotaxime applies to the isomer having a syn-methoxy imino group. |
| Molecular Formula | C16H16N5NaO7S2 |
| CAS# | 64485-93-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [O-]C(C(N1[C@@]2([H])[C@H](NC(/C(C3=CSC(N)=N3)=NO[13C]([2H])([2H])[2H])=O)C1=O)=C(CS2)COC(C)=O)=O.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01071.html |
| Additional Information | NULL |