1R,3S,aS-Deltamethrin
trans-Deltamethrin, is trans isomer of Deltamethrin , a synthetic pyrethroid insecticide, which acts as a potent inhibitor of calcineurin (protein phosphatase 2B) and has an IC50 of about 100pM.
| Catalog Number | CS-T-51810 |
| Alternative Name(s) | 1R,3S,aS-Deltamethrin;trans-Deltamethrin;(1R,3S)-3-(2,2-Dibromoethenyl)-2,2-dimetyano(3-phenoxyphenyl)methyl Ester; [1R-[1a(S*),3?]-3-(2,2-Dibromoethenyl)-2,2-dimetoxylic Acid (S)-Cyano(3-phenoxyphenyl)methyl Ester; NRDC 158B; RU 26979;trans-Deltamethrin. |
| Molecular Formula | C22H19Br2NO3 |
| CAS# | 64363-96-8 |
| Purity | >98% |
| SMILES | O=C([C@@H]1[C@@H](/C=C(Br)/Br)C1(C)C)O[C@@H](C2=CC(OC3=CC=CC=C3)=CC=C2)C#N |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST51810.html |