Atracurium Besilate
API Standard
| Catalog Number | CS-O-00905 |
| Alternative Name(s) | 2,2'-((pentane-1,5-diylbis(oxy))bis(3-oxopropane-3,1-diyl))bis(1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-2-ium) benzenesulfonate |
| Research Area | Atracurium besylate is a non-depolarizing neuromuscular blocking agent with short duration of action. Its lack of significant cardiovascular effects and its lack of dependence on good kidney function for elimination provide clinical advantage over alterna |
| Molecular Formula | C65H82N2O18S2 |
| CAS# | 64228-81-5 |
| Purity | >98% |
| SMILES | O=[S]([O-])(C1=CC=CC=C1)=O.C[N+]2(CCC(OCCCCCOC(CC[N+](C3CC4=CC(OC)=C(OC)C=C4)(CCC5=CC(OC)=C(OC)C=C35)C)=O)=O)C(C6=CC(OC)=C(OC)C=C6CC2)CC7=CC(OC)=C(OC)C=C7.O=[S]([O-])(C8=CC=CC=C8)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00905.html |