Imipenem
API Standard
| Catalog Number | CS-O-30602 |
| Alternative Name(s) | 5R,6S)-3-((2-(Formimidoylamino)ethyl)thio)-6-((R)-1-hydroxyethyl)-7-oxo-1-e. |
| Research Area | Imipenem is stable to beta-lactamases. Clinical studies have demonstrated high efficacy in the treatment of infections of various body systems. Its effectiveness is enhanced when it is administered in combination with CILASTATIN, a renal dipeptidase inhib |
| Molecular Formula | C12H17N3O4S |
| CAS# | 64221-86-9 |
| Purity | >98% |
| SMILES | OC(C(N(C1=O)[C@]([C@@]1([H])[C@H](O)C)([H])C2)=C2SCCNC=N)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30602.html |