MEL24 | MedChemExpress (MCE)
MEL24 is an Mdm2 E3 ligase inhibitor that reduces cell survival and increases sensitivity to DNA damaging agents in a p53-dependent manner for in vitro antitumor studies[1].
| Trivial name | MEL24 |
| Catalog Number | HY-153215 |
| Research Area | Cancer |
| CAS# | 642072-48-8 |
| Purity | ≥98.00% |
| SMILES | O=C1N(C)C(C(C2NCCC3=C2NC4=C3C=CC=C4)C(N1C)=O)=O |
| PubChem Chemical Structure ID | 71451689 |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/mel24.html |