Z-Hyp-OMe | MedChemExpress (MCE)
Z-Hyp-OMe is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | Z-Hyp-OMe |
| Catalog Number | HY-W008370 |
| Research Area | Others |
| CAS# | 64187-48-0 |
| Purity | ≥98.00% |
| SMILES | O=C(OCC1=CC=CC=C1)N2[C@@H](C[C@H](C2)O)C(OC)=O |
| PubChem Chemical Structure ID | 688411 |
| Size | 10 mM * 1 mL |
| Supplier Page | https://www.medchemexpress.com/z-hyp-ome.html |