Pigment red 63:1 | MedChemExpress (MCE)
Pigment red 63:1 is a commonly used commercial dye for bulk coloring of plastics and synthetic fibers and for surface coatings such as paints and inks.
| Trivial name | Pigment red 63:1 |
| Catalog Number | HY-D1164 |
| Alternative Name(s) | D&C Red No. 34 |
| CAS# | 6417-83-0 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(O)C(/N=N/C2=CC=C3C=CC=CC3=C2S(=O)([O-])=O)=C4C=CC=CC4=C1)[O-].[Ca+2] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pigment-red-63-1.html |