4-Phenylbutanoic acid D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03253 |
| Alternative Name(s) | 4-Phenylbutanoic acid D5 |
| Research Area | Labeled Phenylbutanoic acid, intended for use as an internal standard for the quantification of Phenylbutanoic acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C10H12O2 |
| CAS# | 64138-52-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CCCC(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03253.html |
| Additional Information | NULL |