Etimizol
Etimizol is shown to relieve amnesia effectively in the origin of which there is the hypoxic component (hypobaric hypoxia, actinomycin D, mechanical injury of the brain).
| Trivial name | Ethymisole; Antiffine; Ethylnorantifein |
| Catalog Number | CSN18375 |
| Alternative Name(s) | Ethymisole; Antiffine; Ethylnorantifein |
| Research Area | Neurological Disease |
| Molecular Formula | C₉H₁₄N₄O₂ |
| CAS# | 64-99-3 |
| Purity | ≥98% |
| SMILES | O=C(C1=C(C(NC)=O)N(CC)C=N1)NC |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/etimizol.html |