Chlortetracycline HCl
Chlortetracycline HCl is the first tetracycline to be identified, which can inhibit protein synthesis (elongation) by preventing binding of aminoacyl-tRNA to the 30S subunit and is more effective against Gram-positive bacteria.
Trivial name | 7-Chlorotetracycline HCl |
Catalog Number | CSN10627 |
Alternative Name(s) | 7-Chlorotetracycline HCl |
Research Area | Infection |
Molecular Formula | C22H24Cl2N2O8 |
CAS# | 64-72-2 |
Purity | ≥97% |
SMILES | O=C(C(C1=O)=C(O)[C@@H](N(C)C)[C@]2([H])C[C@]3([H])[C@](C)(O)C4=C(C(C3=C(O)[C@@]21O)=O)C(O)=CC=C4Cl)N.[H]Cl |
Size | 250mg |
Supplier Page | https://www.csnpharm.com/products/chlortetracycline-hcl.html |