Chlortetracycline Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01146 |
| Alternative Name(s) | (4S,4aS,6S,12aR)11,12a-pentahydroxy-6-methyl-3,12-dioxo- 3,4,4a,5,5a,6,12,12e-2-carboxamide hydrchloride |
| Research Area | Chlortetracycline is an antibiotic substance isolated from the substrate of Streptomyces aureofaciens. Chlortetracycline is an antimicrobial and antibacterial. |
| Molecular Formula | C22H2Cl2N2O8 |
| CAS# | 64-72-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](C(O)=C(C(C1=C2C(Cl)=CC=C1O)=O)[C@]([C@@]2(O)C)([H])C3)(C(C(C(N)=O)=C4O)=O)[C@]3([H])[C@@H]4N(C)C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01146.html |
| Additional Information | NULL |