Artemisinin 10mM * 1mL in DMSO
Artemisinin and its derivatives are a group of drugs that possess the most rapid action of all current drugs against Plasmodium falciparum malaria.
| Trivial name | Artemisinin 10mM * 1mL in DMSO |
| Catalog Number | A10086-10mM-D |
| Alternative Name(s) | (3R,5aS,6R,8aS,9R,12S,12aR)-octahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10(3H)-one |
| Molecular Formula | C15H22O5 |
| CAS# | 63968-64-9 |
| SMILES | C[C@@H]1CC[C@H]2[C@H](C(=O)O[C@H]3[C@@]24[C@H]1CCC(O3)(OO4)C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/artemisinin.html |
