Meclofenamate Sodium 10mM * 1mL in DMSO
Meclofenamate Sodium is a dual COX-1/COX-2 inhibitor with IC50 of 40 nM and 50 nM.
Trivial name | Meclofenamate Sodium 10mM * 1mL in DMSO |
Catalog Number | A12520-10mM-D |
Alternative Name(s) | 2-[(2,6-dichloro-3-methylphenyl)amino]-benzoic acid, sodium salt (1:1) |
Molecular Formula | C₁₄H₁₁Cl₂NO₂.Na |
CAS# | 6385-02-0 |
SMILES | CC1=C(C(=C(C=C1)Cl)NC2=CC=CC=C2C(=O)[O-])Cl.[Na+] |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/meclofenamate-sodium.html |