SR-13668 5mg
SR-13668 is an Akt inhibitor, is also an orally bioavailable indole-3-carbinol (I3C) analogue inhibitor of the serine/threonine protein kinase Akt (protein kinase B) with potential antineoplastic and antiangiogenic activities.
| Trivial name | SR-13668 5mg |
| Catalog Number | A13554-5 |
| Alternative Name(s) | diethyl 6-methoxy-5,7-dihydroindolo[2,3-b]carbazole-2,10-dicarboxylate |
| Molecular Formula | C25H22N2O5 |
| CAS# | 637774-61-9 |
| SMILES | CCOC(=O)C1=CC2=C3C=C4C5=C(C=CC(=C5)C(=O)OCC)NC4=C(C3=NC2=CC1)OC |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/sr-13668.html |
