Cyclosporine B
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-51503 |
| Alternative Name(s) | Al; |
| Research Area | An immunosuppressant that has revolutionized organ transplantation through its use in the prevention of graft rejection. |
| Molecular Formula | C61H109N11O12 |
| CAS# | 63775-95-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H]([C@](C(N[C@H](C(N(CC(N([C@H](C(N[C@@](C(N([C@H]1CC(C)C)C)=O)([H])C(C)C)=O)CC(C)C)C)=O)C)=O)C)=O)([H])N(C([C@](N(C([C@@H](N(C([C@](N(C([C@H](NC([C@@H](NC1=O)C)=O)C)=O)C)([H])CC(C)C)=O)C)CC(C)C)=O)C)([H])C(C)C)=O)C)[C@H](C)C/C=C/C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST51503.html |
| Additional Information | NULL |