(R)-Baclofen HCl
(R)-Baclofen HCl is a derivative of gamma-aminobutyric acid (GABA) primarily used to treat spasticity and is in the early research stages for use for the treatment of alcoholism.
| Trivial name | STX 209 HCl |
| Catalog Number | CSN11821 |
| Alternative Name(s) | STX 209 HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C10H13Cl2NO2 |
| CAS# | 63701-55-3 |
| Purity | ≥98% |
| SMILES | ClC1=CC=C([C@](CC(O)=O)([H])CN)C=C1.Cl |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/(r)-baclofen-hcl.html |