Clofibrate
Clofibrate, a fibric acid derivative, is a selective agonist of peroxisome proliferator-activated receptor α (PPARα) with EC50 of 50 µM. Clofibrate has been used to treat hyperlipoproteinemia type III and severe hypertriglyceridemia.
| Trivial name | / |
| Catalog Number | CSN11481 |
| Alternative Name(s) | / |
| Research Area | Cancer|Cardiovascular Disease |
| Molecular Formula | C12H15ClO3 |
| CAS# | 637-07-0 |
| Purity | ≥98% |
| SMILES | CC(C)(OC1=CC=C(Cl)C=C1)C(OCC)=O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/clofibrate.html |
