Nisoldipine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30680 |
| Alternative Name(s) | 3-methyl 5-(2-methylpropyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dcarboxylate |
| Research Area | Nisoldipine is a 1,4-dihydropyridine calcium channel blocker. It acts primarily on vascular smooth muscle cells by stabilizing voltage-gated L-type calcium channels in their inactive conformation. By inhibiting the influx of calcium in smooth muscle cells |
| Molecular Formula | C20H24N2O6 |
| CAS# | 63675-72-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(C(C=CC=C1)=C1[N+]([O-])=O)C(C(OC)=O)=C(C)N2)=C2C)OCC(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30680.html |
| Additional Information | NULL |