Betaxolol 50mg
Betaxolol is a selective beta1 receptor blocker used in the treatment of hypertension and glaucoma. Being selective for beta1 receptors, it typically has fewer systemic side effects than non-selective beta-blockers, for example, not causing bronchospasm (mediated by beta2 receptors) as timolol may. Betaxolol also shows greater affininty for beta1 receptors than metoprolol.
| Trivial name | Betaxolol 50mg |
| Catalog Number | A11721-50 |
| Alternative Name(s) | N/A |
| Molecular Formula | C18H29NO3 |
| CAS# | 63659-18-7 |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCOCC2CC2)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/betaxolol.html |
