Pazopanib hydrochloride
Inhibitors
| Trivial name | NULL |
| Catalog Number | CS-CW-00177 |
| Alternative Name(s) | 5-((4-((2,3-dimethyl-2H-indazol-6-yl)(methyl)amino)pyrimidin-2-yl)amino)-2-methylbenzenesulfonamide hydrochloride |
| Research Area | A potent and selective inhibitor of tyrosine kinases, targeting VEGFR/c-KIT/PDGFR, blocking angiogenesis; as an oral antineoplastic agent |
| Molecular Formula | C21H23N7O2S.HCl |
| CAS# | 635702-64-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(C=CC(N(C2=NC(NC3=CC([S](N)(=O)=O)=C(C)C=C3)=NC=C2)C)=C4)C4=NN1C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSCW00177.html |
| Additional Information | NULL |