(±)-N-Formyl Octabase
(±)-N-Formyl Octabase is an intermediate in the synthesis of (±)-3-Methoxy-17-methylmorphinan Hydrobromide (M329120), the racemic mixture of Dextromethorphan (D299445) and Levomethorphan (L375850). Dextromethorphan is an antitussive compound showing analgesic properties; used in cough medication formulations. Levomethorphan is an antitussive medicine, a narcotic and controlled substance.
| Catalog Number | BB064586 |
| Alternative Name(s) | 3,4,5,6,7,8-Hexahydro-1-[(4-methoxyphenyl)methyl]-2(1H)-isoquinolinecarboxaldehyde;2-Formyl-1-(4-methoxybenzyl)-1,2,3,4,5,6,7,8-octahydroisoquinoline |
| Molecular Formula | C18H23NO2 |
| CAS# | 63477-91-8 |
| Inchi | InChI=1S/C18H23NO2/c1-21-16-8-6-14(7-9-16)12-18-17-5-3-2-4-15(17)10-11-19(18)13-20/h6-9,13,18H,2-5,10-12H2,1H3 |
| Inchi Key | XSOPBBOEINVWML-UHFFFAOYSA-N |
| Size | Please inquire |
| Supplier Page | https://buildingblock.bocsci.com/product/n-formyl-octabase-cas-63477-91-8-397490.html |
