Berberine Hydrochloride 10mg
Berberine hydrochloride was novelly found that it has various beneficial effects on the cardiovascular system and significant anti-inflammatory activities. Berberine can effectively reduce intracellular superoxide levels in LPS-stimulated macrophages. Such a restoration of cellular redox by berberine is mediated by its selective inhibition of gp91phox expression and enhancement of SOD activity.
| Trivial name | Berberine Hydrochloride 10mg |
| Catalog Number | A10126-10 |
| Alternative Name(s) | 5,?€?6-?€?dihydro-?€?9,?€?10-?€?dimethoxy-?€?benzo[g]-?€?1,?€?3-?€?benzodioxolo[5,?€?6-?€?a]quinolizinium,?€? chloride |
| Molecular Formula | C20H18ClNO4 |
| CAS# | 633-65-8 |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-] |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/berberine-hydrochloride.html |
