2,3-Dinor thromboxane B2 | MedChemExpress (MCE)
2,3-Dinor thromboxane B2 (2,3-Dinor-TXB2), a metabolite of urine, serves as an indicator of the production of thromboxane A2 (TxA2) in the body, and can be used as a tool to study the role of thromboxane in various pathophysiological processes in the human body[1].
| Trivial name | 2,3-Dinor thromboxane B2 |
| Catalog Number | HY-126923 |
| Alternative Name(s) | 2,3-Dinor-TXB2 |
| Research Area | Metabolic Disease; Cardiovascular Disease |
| CAS# | 63250-09-9 |
| Purity | ≥98.0% |
| SMILES | O=C(O)C/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H](O)C[C@@H]1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-3-dinor-thromboxane-b2.html |