Wogonin 10mg
Wogonin is an anti-inflammatory agent and COX-2 inhibitor, which inhibits the induction of both iNOS and COX-2. Wogonin inhibits COX-2 (IC50 = 46 uM) without affecting COX-1. Wogonin enhances antitumor activity of tumor necrosis factor-related apoptosis-inducing ligand in vivo through ROS-mediated downregulation of cFLIPL and IAP proteins.
| Trivial name | Wogonin 10mg |
| Catalog Number | A12216-10 |
| Alternative Name(s) | 5,7-Dihydroxy-8-methoxyflavone |
| Molecular Formula | C16H12O5.xH2O |
| CAS# | 632-85-9 (anhydrous) |
| SMILES | COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=CC=C3)O)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/wogonin.html |
