Magnesium Valproate
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-30983 |
| Alternative Name(s) | magnesium 2-propylpentanoate;magnesium 2-propylpentanoate |
| Research Area | Magnesium Valproate is an anticonvulsant agent and the effects it exerts are the result of valproic acid and magnesium acting in a complementary way. Magnesium valproate is effective as monotherapy in patients with newly diagnosed or previously treated partial or generalised epilepsy. |
| Molecular Formula | C16H30MgO4 |
| CAS# | 62959-43-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [O-]C(C(CCC)CCC)=O.[O-]C(C(CCC)CCC)=O.[Mg+2] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30983.html |
| Additional Information | NULL |