Mulberrin
Mulberrin can act as HIV-1 reverse transcriptase inhibitor and reduce blood sugar of type II diabetes in rats. It is purified from the root bark of morus alba L.
| Trivial name | / |
| Catalog Number | CSN14602 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C25H26O6 |
| CAS# | 62949-79-5 |
| Purity | ≥98% |
| SMILES | C/C(C)=C\CC1=C2C(C(C(C/C=C(C)\C)=C(O2)C3=C(O)C=C(O)C=C3)=O)=C(O)C=C1O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/mulberrin.html |
