Kuwanon A
Kuwanon A is a flavone derivative isolated from the root barks of the mulberry tree (Morus alba L.) and inhibits nitric oxide production with IC50 of 10.5 μM.
| Trivial name | / |
| Catalog Number | CSN22080 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C25H24O6 |
| CAS# | 62949-77-3 |
| Purity | ≥97% |
| SMILES | O=C1C(CC=C(C)C)=C(C2=CC=C(O)C3=C2OC(C)(C)C=C3)OC4=C1C(O)=CC(O)=C4 |
| Size | 2mg |
| Supplier Page | https://www.csnpharm.com/products/kuwanon-a.html |