(+)-O,O′-Diacetyl-L-tartaric anhydride
(+)-O,O′-Diacetyl-L-tartaric anhydride is an HPLC derivatization reagent for UV/Vis detection. It is mainly employed as a reagent for the chiral derivatization of amino alcohols. It also reacts with alkanoamines in aprotic medium containing trichloroacetic acid and produces tartaric acid monoesters.
| Catalog Number | CBB1114775 |
| Alternative Name(s) | (+)-Diacetyl-L-tartaric anhydride |
| Molecular Formula | C8H8O7 |
| CAS# | 6283-74-5 |
| Purity | >97% |
| Inchi | 1S/C8H8O7/c1-3(9)13-5-6(14-4(2)10)8(12)15-7(5)11/h5-6H,1-2H3/t5-,6-/m1/s1 |
| Inchi Key | XAKITKDHDMPGPW-PHDIDXHHSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)C(=O)OC1=O |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/oo-diacetyl-l-tartaric-anhydride-item-114775.html |
