6β-Prostaglandin I1 | MedChemExpress (MCE)
6β-Prostaglandin I1 (6β-PGI1) is an analog of prostaglandin I2 (PGI2) that is resistant to hydrolysis in aqueous solutions. 6β-Prostaglandin I1 can reduce gastric acid secretion with an ID50 (dose causing 50% inhibition) of approximately 3.0 μg/kg/min (intravenous injection)[1].
| Trivial name | 6β-Prostaglandin I1 |
| Catalog Number | HY-130522 |
| Alternative Name(s) | 6β-PGI1 |
| Research Area | Others |
| CAS# | 62770-50-7 |
| Purity | ≥98.0% |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@]2([H])[C@@](C[C@H]1O)([H])O[C@H](C2)CCCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/6β-prostaglandin-i1.html |