BMS564929 25mg
BMS-564929 is a novel, highly potent, orally active, nonsteroidal tissue selective androgen receptor (AR) modulator, and this compound has been advanced to clinical trials for the treatment of age-related functional decline.
| Trivial name | BMS564929 25mg |
| Catalog Number | A12805-25 |
| Alternative Name(s) | N/A |
| Molecular Formula | C14H12ClN3O3 |
| CAS# | 627530-84-1 |
| SMILES | CC1=C(C=CC(=C1Cl)C#N)N2C(=O)[C@@H]3[C@@H](CCN3C2=O)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/bms564929.html |
