Zincon sodium | MedChemExpress (MCE)
Zincon sodium is an excellent colorimetric reagent for the detection of zinc and copper ions in aqueous solution. Zincon sodium can be used for the determination of zinc, copper, and cobalt ions in metalloproteins[1].
| Trivial name | Zincon sodium |
| Catalog Number | HY-D0813 |
| Research Area | Others |
| CAS# | 62625-22-3 |
| Purity | ≥98.00% |
| SMILES | O=C(C1=C(N/N=C(C2=CC=CC=C2)/N=N/C3=CC(S(=O)(O[Na])=O)=CC=C3O)C=CC=C1)O |
| PubChem Chemical Structure ID | 135472945 |
| Size | 1 g |
| Supplier Page | https://www.medchemexpress.com/zincon-sodium.html |